C37H50O13 — CID 122187917
[(1S,2S,4S,5R,6S,7R,8R,9R,12R)-4,5,12-triacetyloxy-2-hydroxy-2,10,10-trimethyl-6-(3-methyl-2-oxopentyl)-8-(2-methylpropanoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate (PubChem CID 122187917) has the molecular formula C37H50O13 and a molecular weight of 702.79 g/mol. Its IUPAC name is [(1S,2S,4S,5R,6S,7R,8R,9R,12R)-4,5,12-triacetyloxy-2-hydroxy-2,10,10-trimethyl-6-(3-methyl-2-oxopentyl)-8-(2-methylpropanoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate.
| Compound Name | [(1S,2S,4S,5R,6S,7R,8R,9R,12R)-4,5,12-triacetyloxy-2-hydroxy-2,10,10-trimethyl-6-(3-methyl-2-oxopentyl)-8-(2-methylpropanoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate |
|---|---|
| PubChem CID | 122187917 |
| Molecular Formula | C37H50O13 |
| Molecular Weight | 702.79 g/mol |
| Exact Mass | 702.33 |
| IUPAC Name | [(1S,2S,4S,5R,6S,7R,8R,9R,12R)-4,5,12-triacetyloxy-2-hydroxy-2,10,10-trimethyl-6-(3-methyl-2-oxopentyl)-8-(2-methylpropanoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] benzoate |
| SMILES | CCC(C)C(=O)C[C@]12[C@@H](OC(=O)c3ccccc3)[C@H](OC(=O)C(C)C)[C@@H]3[C@@H](OC(C)=O)[C@]1(OC3(C)C)[C@@](C)(O)C[C@H](OC(C)=O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C37H50O13/c1-11-20(4)25(41)17-36-29(46-22(6)39)26(45-21(5)38)18-35(10,44)37(36)30(47-23(7)40)27(34(8,9)50-37)28(48-32(42)19(2)3)31(36)49-33(43)24-15-13-12-14-16-24/h12-16,19-20,26-31,44H,11,17-18H2,1-10H3/t20?,26-,27+,28+,29-,30+,31-,35-,36-,37-/m0/s1 |
| InChIKey | CRKZCXFGTREICY-JKRHYGAHSA-N |
| XLogP | 3.90 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|