C30H40O14 — CID 102076079
[(1S,2R,6R,9R)-4,5,12-triacetyloxy-2,8-dihydroxy-2,10,10-trimethyl-6-(2-methylpropanoyloxymethyl)-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-3-carboxylate (PubChem CID 102076079) has the molecular formula C30H40O14 and a molecular weight of 624.64 g/mol. Its IUPAC name is [(1S,2R,6R,9R)-4,5,12-triacetyloxy-2,8-dihydroxy-2,10,10-trimethyl-6-(2-methylpropanoyloxymethyl)-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-3-carboxylate.
| Compound Name | [(1S,2R,6R,9R)-4,5,12-triacetyloxy-2,8-dihydroxy-2,10,10-trimethyl-6-(2-methylpropanoyloxymethyl)-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-3-carboxylate |
|---|---|
| PubChem CID | 102076079 |
| Molecular Formula | C30H40O14 |
| Molecular Weight | 624.64 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | [(1S,2R,6R,9R)-4,5,12-triacetyloxy-2,8-dihydroxy-2,10,10-trimethyl-6-(2-methylpropanoyloxymethyl)-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-3-carboxylate |
| SMILES | CC(=O)OC1C[C@@](C)(O)[C@]23OC(C)(C)[C@H](C(O)C(OC(=O)c4ccoc4)[C@]2(COC(=O)C(C)C)C1OC(C)=O)C3OC(C)=O |
| InChI | InChI=1S/C30H40O14/c1-14(2)25(35)39-13-29-22(41-16(4)32)19(40-15(3)31)11-28(8,37)30(29)23(42-17(5)33)20(27(6,7)44-30)21(34)24(29)43-26(36)18-9-10-38-12-18/h9-10,12,14,19-24,34,37H,11,13H2,1-8H3/t19?,20-,21?,22?,23?,24?,28-,29+,30+/m1/s1 |
| InChIKey | TVBWLIHGYCOSQU-BIZHMDHUSA-N |
| XLogP | 1.48 |
| TPSA | 194.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.64 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|