C32H46O11 — CID 163025385
[(1R,2S,4S,5R,6R,7S,9R)-6-(acetyloxymethyl)-2-hydroxy-2,10,10-trimethyl-4-[(2S)-2-methylbutanoyl]oxy-5-[(2R)-2-methylbutanoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-3-carboxylate (PubChem CID 163025385) has the molecular formula C32H46O11 and a molecular weight of 606.71 g/mol. Its IUPAC name is [(1R,2S,4S,5R,6R,7S,9R)-6-(acetyloxymethyl)-2-hydroxy-2,10,10-trimethyl-4-[(2S)-2-methylbutanoyl]oxy-5-[(2R)-2-methylbutanoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-3-carboxylate.
| Compound Name | [(1R,2S,4S,5R,6R,7S,9R)-6-(acetyloxymethyl)-2-hydroxy-2,10,10-trimethyl-4-[(2S)-2-methylbutanoyl]oxy-5-[(2R)-2-methylbutanoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-3-carboxylate |
|---|---|
| PubChem CID | 163025385 |
| Molecular Formula | C32H46O11 |
| Molecular Weight | 606.71 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | [(1R,2S,4S,5R,6R,7S,9R)-6-(acetyloxymethyl)-2-hydroxy-2,10,10-trimethyl-4-[(2S)-2-methylbutanoyl]oxy-5-[(2R)-2-methylbutanoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] furan-3-carboxylate |
| SMILES | CC[C@@H](C)C(=O)O[C@H]1[C@@H](OC(=O)[C@@H](C)CC)C[C@](C)(O)[C@@]23C[C@@H](C[C@H](OC(=O)c4ccoc4)[C@]12COC(C)=O)C(C)(C)O3 |
| InChI | InChI=1S/C32H46O11/c1-9-18(3)26(34)40-23-15-30(8,37)32-14-22(29(6,7)43-32)13-24(41-28(36)21-11-12-38-16-21)31(32,17-39-20(5)33)25(23)42-27(35)19(4)10-2/h11-12,16,18-19,22-25,37H,9-10,13-15,17H2,1-8H3/t18-,19+,22+,23-,24-,25-,30-,31+,32-/m0/s1 |
| InChIKey | RZKHWBQSRXGRFP-AZEZANHTSA-N |
| XLogP | 4.38 |
| TPSA | 147.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.71 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|