C17H15IO3 — CID 63709913
3,4-dihydro-2H-chromen-4-yl-(5-iodo-2-methoxyphenyl)methanone (PubChem CID 63709913) has the molecular formula C17H15IO3 and a molecular weight of 394.21 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-4-yl-(5-iodo-2-methoxyphenyl)methanone.
| Compound Name | 3,4-dihydro-2H-chromen-4-yl-(5-iodo-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 63709913 |
| Molecular Formula | C17H15IO3 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 3,4-dihydro-2H-chromen-4-yl-(5-iodo-2-methoxyphenyl)methanone |
| SMILES | COc1ccc(I)cc1C(=O)C1CCOc2ccccc21 |
| InChI | InChI=1S/C17H15IO3/c1-20-15-7-6-11(18)10-14(15)17(19)13-8-9-21-16-5-3-2-4-12(13)16/h2-7,10,13H,8-9H2,1H3 |
| InChIKey | GMILMBOLVUHASZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|