C11H19N5O5S — CID 59671245
[(1R,2R,3S,4R)-4-[(6-amino-2-methylpyrimidin-4-yl)amino]-2,3-dihydroxycyclopentyl]methyl sulfamate (PubChem CID 59671245) has the molecular formula C11H19N5O5S and a molecular weight of 333.37 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-[(6-amino-2-methylpyrimidin-4-yl)amino]-2,3-dihydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-4-[(6-amino-2-methylpyrimidin-4-yl)amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 59671245 |
| Molecular Formula | C11H19N5O5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [(1R,2R,3S,4R)-4-[(6-amino-2-methylpyrimidin-4-yl)amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
| SMILES | Cc1nc(N)cc(N[C@@H]2C[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C11H19N5O5S/c1-5-14-8(12)3-9(15-5)16-7-2-6(10(17)11(7)18)4-21-22(13,19)20/h3,6-7,10-11,17-18H,2,4H2,1H3,(H2,13,19,20)(H3,12,14,15,16)/t6-,7-,10-,11+/m1/s1 |
| InChIKey | XZXIENFQFIXAOU-CCXSFMJYSA-N |
| XLogP | -1.89 |
| TPSA | 173.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |