C17H29N5O5S — CID 24829868
[(1R,2R,3S,4R)-4-[[2-(cyclohexylmethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate (PubChem CID 24829868) has the molecular formula C17H29N5O5S and a molecular weight of 415.52 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-[[2-(cyclohexylmethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-4-[[2-(cyclohexylmethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 24829868 |
| Molecular Formula | C17H29N5O5S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | [(1R,2R,3S,4R)-4-[[2-(cyclohexylmethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ccnc(NCC3CCCCC3)n2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H29N5O5S/c18-28(25,26)27-10-12-8-13(16(24)15(12)23)21-14-6-7-19-17(22-14)20-9-11-4-2-1-3-5-11/h6-7,11-13,15-16,23-24H,1-5,8-10H2,(H2,18,25,26)(H2,19,20,21,22)/t12-,13-,15-,16+/m1/s1 |
| InChIKey | FTQUIPPXVTVAKQ-XOUADPBQSA-N |
| XLogP | 0.21 |
| TPSA | 159.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |