C11H16F2N4O4S — CID 142698723
2-[(1R,2R,3S,4R)-2,3-dihydroxy-4-(pyrimidin-4-ylamino)cyclopentyl]-1,1-difluoroethanesulfonamide (PubChem CID 142698723) has the molecular formula C11H16F2N4O4S and a molecular weight of 338.34 g/mol. Its IUPAC name is 2-[(1R,2R,3S,4R)-2,3-dihydroxy-4-(pyrimidin-4-ylamino)cyclopentyl]-1,1-difluoroethanesulfonamide.
| Compound Name | 2-[(1R,2R,3S,4R)-2,3-dihydroxy-4-(pyrimidin-4-ylamino)cyclopentyl]-1,1-difluoroethanesulfonamide |
|---|---|
| PubChem CID | 142698723 |
| Molecular Formula | C11H16F2N4O4S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-[(1R,2R,3S,4R)-2,3-dihydroxy-4-(pyrimidin-4-ylamino)cyclopentyl]-1,1-difluoroethanesulfonamide |
| SMILES | NS(=O)(=O)C(F)(F)C[C@H]1C[C@@H](Nc2ccncn2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H16F2N4O4S/c12-11(13,22(14,20)21)4-6-3-7(10(19)9(6)18)17-8-1-2-15-5-16-8/h1-2,5-7,9-10,18-19H,3-4H2,(H2,14,20,21)(H,15,16,17)/t6-,7-,9-,10+/m1/s1 |
| InChIKey | WTEKZZJUIRKXJM-ZXZZCXTASA-N |
| XLogP | -0.73 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |