C12H18N2O3S — CID 79366308
2-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]ethanesulfonamide (PubChem CID 79366308) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]ethanesulfonamide.
| Compound Name | 2-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 79366308 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)amino]ethanesulfonamide |
| SMILES | COc1ccc2c(c1)C(NCCS(N)(=O)=O)CC2 |
| InChI | InChI=1S/C12H18N2O3S/c1-17-10-4-2-9-3-5-12(11(9)8-10)14-6-7-18(13,15)16/h2,4,8,12,14H,3,5-7H2,1H3,(H2,13,15,16) |
| InChIKey | UPVIIYYDOARYQS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |