C23H32N4O6S — CID 150650403
[(1S,2S,4R)-2-hydroxy-4-[6-[[(1R,2S)-2-methoxy-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]amino]pyrimidin-4-yl]oxycyclopentyl] N-methylsulfamate (PubChem CID 150650403) has the molecular formula C23H32N4O6S and a molecular weight of 492.60 g/mol. Its IUPAC name is [(1S,2S,4R)-2-hydroxy-4-[6-[[(1R,2S)-2-methoxy-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]amino]pyrimidin-4-yl]oxycyclopentyl] N-methylsulfamate.
| Compound Name | [(1S,2S,4R)-2-hydroxy-4-[6-[[(1R,2S)-2-methoxy-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]amino]pyrimidin-4-yl]oxycyclopentyl] N-methylsulfamate |
|---|---|
| PubChem CID | 150650403 |
| Molecular Formula | C23H32N4O6S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | [(1S,2S,4R)-2-hydroxy-4-[6-[[(1R,2S)-2-methoxy-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]amino]pyrimidin-4-yl]oxycyclopentyl] N-methylsulfamate |
| SMILES | CNS(=O)(=O)O[C@H]1C[C@H](Oc2cc(N[C@@H]3c4ccccc4C(C)(C)C[C@@H]3OC)ncn2)C[C@@H]1O |
| InChI | InChI=1S/C23H32N4O6S/c1-23(2)12-19(31-4)22(15-7-5-6-8-16(15)23)27-20-11-21(26-13-25-20)32-14-9-17(28)18(10-14)33-34(29,30)24-3/h5-8,11,13-14,17-19,22,24,28H,9-10,12H2,1-4H3,(H,25,26,27)/t14-,17+,18+,19+,22-/m1/s1 |
| InChIKey | JBTGQBHVZDNJFP-JYTXLUNMSA-N |
| XLogP | 2.08 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |