C18H21N3O3 — CID 159358233
N-[6-[(1R,3S,4S)-3-ethyl-4-hydroxycyclopentyl]oxypyrimidin-4-yl]benzamide (PubChem CID 159358233) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-[6-[(1R,3S,4S)-3-ethyl-4-hydroxycyclopentyl]oxypyrimidin-4-yl]benzamide.
| Compound Name | N-[6-[(1R,3S,4S)-3-ethyl-4-hydroxycyclopentyl]oxypyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 159358233 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[6-[(1R,3S,4S)-3-ethyl-4-hydroxycyclopentyl]oxypyrimidin-4-yl]benzamide |
| SMILES | CC[C@H]1C[C@@H](Oc2cc(NC(=O)c3ccccc3)ncn2)C[C@@H]1O |
| InChI | InChI=1S/C18H21N3O3/c1-2-12-8-14(9-15(12)22)24-17-10-16(19-11-20-17)21-18(23)13-6-4-3-5-7-13/h3-7,10-12,14-15,22H,2,8-9H2,1H3,(H,19,20,21,23)/t12-,14+,15-/m0/s1 |
| InChIKey | JSEDWFUDNHEJNF-CFVMTHIKSA-N |
| XLogP | 2.66 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |