C22H28FN5O5S — CID 139423785
[(2S,3R)-2-ethyl-4-[5-fluoro-4-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxybutyl] sulfamate (PubChem CID 139423785) has the molecular formula C22H28FN5O5S and a molecular weight of 493.56 g/mol. Its IUPAC name is [(2S,3R)-2-ethyl-4-[5-fluoro-4-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxybutyl] sulfamate.
| Compound Name | [(2S,3R)-2-ethyl-4-[5-fluoro-4-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxybutyl] sulfamate |
|---|---|
| PubChem CID | 139423785 |
| Molecular Formula | C22H28FN5O5S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | [(2S,3R)-2-ethyl-4-[5-fluoro-4-[[(1R,2S)-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3-hydroxybutyl] sulfamate |
| SMILES | CC[C@@H](COS(N)(=O)=O)[C@@H](O)Cn1cc(F)c2c(N[C@@H]3c4ccccc4C[C@@H]3OC)ncnc21 |
| InChI | InChI=1S/C22H28FN5O5S/c1-3-13(11-33-34(24,30)31)17(29)10-28-9-16(23)19-21(25-12-26-22(19)28)27-20-15-7-5-4-6-14(15)8-18(20)32-2/h4-7,9,12-13,17-18,20,29H,3,8,10-11H2,1-2H3,(H2,24,30,31)(H,25,26,27)/t13-,17-,18-,20+/m0/s1 |
| InChIKey | CZUBLNRAHAGFIR-HKVPTBLXSA-N |
| XLogP | 1.90 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |