C21H24FN5O4S — CID 121433695
[(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl]-2-hydroxycyclopentyl]-methylsulfamic acid (PubChem CID 121433695) has the molecular formula C21H24FN5O4S and a molecular weight of 461.52 g/mol. Its IUPAC name is [(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl]-2-hydroxycyclopentyl]-methylsulfamic acid.
| Compound Name | [(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl]-2-hydroxycyclopentyl]-methylsulfamic acid |
|---|---|
| PubChem CID | 121433695 |
| Molecular Formula | C21H24FN5O4S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | [(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl]-2-hydroxycyclopentyl]-methylsulfamic acid |
| SMILES | CN([C@H]1C[C@@H](n2cc(F)c3c(N[C@H]4CCc5ccccc54)ncnc32)C[C@@H]1O)S(=O)(=O)O |
| InChI | InChI=1S/C21H24FN5O4S/c1-26(32(29,30)31)17-8-13(9-18(17)28)27-10-15(22)19-20(23-11-24-21(19)27)25-16-7-6-12-4-2-3-5-14(12)16/h2-5,10-11,13,16-18,28H,6-9H2,1H3,(H,23,24,25)(H,29,30,31)/t13-,16+,17+,18+/m1/s1 |
| InChIKey | CABGRJLCQZDDGA-QCSYZSNVSA-N |
| XLogP | 2.47 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|