C21H24FN5O4S — CID 141445519
methyl N-[(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl]-2-hydroxycyclopentyl]sulfamate (PubChem CID 141445519) has the molecular formula C21H24FN5O4S and a molecular weight of 461.52 g/mol. Its IUPAC name is methyl N-[(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl]-2-hydroxycyclopentyl]sulfamate.
| Compound Name | methyl N-[(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl]-2-hydroxycyclopentyl]sulfamate |
|---|---|
| PubChem CID | 141445519 |
| Molecular Formula | C21H24FN5O4S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | methyl N-[(1S,2S,4R)-4-[4-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl]-2-hydroxycyclopentyl]sulfamate |
| SMILES | COS(=O)(=O)N[C@H]1C[C@@H](n2cc(F)c3c(N[C@H]4CCc5ccccc54)ncnc32)C[C@@H]1O |
| InChI | InChI=1S/C21H24FN5O4S/c1-31-32(29,30)26-17-8-13(9-18(17)28)27-10-15(22)19-20(23-11-24-21(19)27)25-16-7-6-12-4-2-3-5-14(12)16/h2-5,10-11,13,16-18,26,28H,6-9H2,1H3,(H,23,24,25)/t13-,16+,17+,18+/m1/s1 |
| InChIKey | WYMKAGWVRUKMGW-QCSYZSNVSA-N |
| XLogP | 2.21 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |