C33H33N3O3Si — CID 156705334
(1S,2R,3aR,4S,6aR)-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-4-triphenylsilyloxy-2,3,3a,4,5,6-hexahydro-1H-pentalene-1,6a-diol (PubChem CID 156705334) has the molecular formula C33H33N3O3Si and a molecular weight of 547.73 g/mol. Its IUPAC name is (1S,2R,3aR,4S,6aR)-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-4-triphenylsilyloxy-2,3,3a,4,5,6-hexahydro-1H-pentalene-1,6a-diol.
| Compound Name | (1S,2R,3aR,4S,6aR)-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-4-triphenylsilyloxy-2,3,3a,4,5,6-hexahydro-1H-pentalene-1,6a-diol |
|---|---|
| PubChem CID | 156705334 |
| Molecular Formula | C33H33N3O3Si |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | (1S,2R,3aR,4S,6aR)-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-4-triphenylsilyloxy-2,3,3a,4,5,6-hexahydro-1H-pentalene-1,6a-diol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1C[C@@H]2[C@@H](O[Si](c3ccccc3)(c3ccccc3)c3ccccc3)CC[C@]2(O)[C@H]1O |
| InChI | InChI=1S/C33H33N3O3Si/c1-23-27-18-20-36(32(27)35-22-34-23)29-21-28-30(17-19-33(28,38)31(29)37)39-40(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-16,18,20,22,28-31,37-38H,17,19,21H2,1H3/t28-,29-,30+,31+,33-/m1/s1 |
| InChIKey | JBXHJHWVOOVEFL-HVXHYHBXSA-N |
| XLogP | 3.24 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|