C20H20N5O3+ — CID 140735420
(2R,3R,4S,5S)-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(1-phenyl-4H-pyrazol-1-ium-3-yl)oxolane-3,4-diol (PubChem CID 140735420) has the molecular formula C20H20N5O3+ and a molecular weight of 378.41 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(1-phenyl-4H-pyrazol-1-ium-3-yl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(1-phenyl-4H-pyrazol-1-ium-3-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 140735420 |
| Molecular Formula | C20H20N5O3+ |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (2R,3R,4S,5S)-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-(1-phenyl-4H-pyrazol-1-ium-3-yl)oxolane-3,4-diol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1O[C@@H](C2=N[N+](c3ccccc3)=CC2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H20N5O3/c1-12-14-7-9-24(19(14)22-11-21-12)20-17(27)16(26)18(28-20)15-8-10-25(23-15)13-5-3-2-4-6-13/h2-7,9-11,16-18,20,26-27H,8H2,1H3/q+1/t16-,17+,18-,20+/m0/s1 |
| InChIKey | PCBQDNMLWWNBMZ-HLNWXESRSA-N |
| XLogP | 1.53 |
| TPSA | 95.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|