C24H27N5O3 — CID 167377092
(1R,2S,3R,5S)-5-[(2-amino-3-methylquinolin-7-yl)oxymethyl]-1-methyl-3-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1,2-diol (PubChem CID 167377092) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is (1R,2S,3R,5S)-5-[(2-amino-3-methylquinolin-7-yl)oxymethyl]-1-methyl-3-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5S)-5-[(2-amino-3-methylquinolin-7-yl)oxymethyl]-1-methyl-3-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 167377092 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (1R,2S,3R,5S)-5-[(2-amino-3-methylquinolin-7-yl)oxymethyl]-1-methyl-3-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1,2-diol |
| SMILES | Cc1cc2ccc(OC[C@@H]3C[C@@H](n4ccc5c(C)ncnc54)[C@H](O)[C@]3(C)O)cc2nc1N |
| InChI | InChI=1S/C24H27N5O3/c1-13-8-15-4-5-17(10-19(15)28-22(13)25)32-11-16-9-20(21(30)24(16,3)31)29-7-6-18-14(2)26-12-27-23(18)29/h4-8,10,12,16,20-21,30-31H,9,11H2,1-3H3,(H2,25,28)/t16-,20+,21-,24+/m0/s1 |
| InChIKey | XXNKAKLMXFOYKQ-OEZJKNOUSA-N |
| XLogP | 2.93 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |