C16H19N3O2 — CID 170391836
(1S,3S,6R,7aS)-3-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,5,6,7,7a-hexahydro-1H-indene-1,6-diol (PubChem CID 170391836) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is (1S,3S,6R,7aS)-3-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,5,6,7,7a-hexahydro-1H-indene-1,6-diol.
| Compound Name | (1S,3S,6R,7aS)-3-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,5,6,7,7a-hexahydro-1H-indene-1,6-diol |
|---|---|
| PubChem CID | 170391836 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (1S,3S,6R,7aS)-3-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-2,3,5,6,7,7a-hexahydro-1H-indene-1,6-diol |
| SMILES | Cc1ncnc2c1ccn2[C@H]1C[C@H](O)[C@H]2C[C@H](O)CC=C21 |
| InChI | InChI=1S/C16H19N3O2/c1-9-11-4-5-19(16(11)18-8-17-9)14-7-15(21)13-6-10(20)2-3-12(13)14/h3-5,8,10,13-15,20-21H,2,6-7H2,1H3/t10-,13+,14+,15+/m1/s1 |
| InChIKey | DWYYTYGWSCVKIE-KJEVXHAQSA-N |
| XLogP | 1.74 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|