C19H18ClN3O3S — CID 139488576
(2S,3S,4R,5R)-2-[(1R)-5-chloro-1,3-dihydro-2-benzothiophen-1-yl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol (PubChem CID 139488576) has the molecular formula C19H18ClN3O3S and a molecular weight of 403.89 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[(1R)-5-chloro-1,3-dihydro-2-benzothiophen-1-yl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-[(1R)-5-chloro-1,3-dihydro-2-benzothiophen-1-yl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 139488576 |
| Molecular Formula | C19H18ClN3O3S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | (2S,3S,4R,5R)-2-[(1R)-5-chloro-1,3-dihydro-2-benzothiophen-1-yl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)oxolane-3,4-diol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1O[C@H]([C@@H]2SCc3cc(Cl)ccc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H18ClN3O3S/c1-9-12-4-5-23(18(12)22-8-21-9)19-15(25)14(24)16(26-19)17-13-3-2-11(20)6-10(13)7-27-17/h2-6,8,14-17,19,24-25H,7H2,1H3/t14-,15+,16-,17+,19+/m0/s1 |
| InChIKey | QOENSCBBWPUHTL-HTBDUDNFSA-N |
| XLogP | 3.00 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |