C19H19ClN6O — CID 142419678
2-[[1-[3-[(4-chlorophenyl)-hydroxymethyl]cyclopentyl]pyrazolo[3,4-d]pyrimidin-4-yl]amino]acetonitrile (PubChem CID 142419678) has the molecular formula C19H19ClN6O and a molecular weight of 382.86 g/mol. Its IUPAC name is 2-[[1-[3-[(4-chlorophenyl)-hydroxymethyl]cyclopentyl]pyrazolo[3,4-d]pyrimidin-4-yl]amino]acetonitrile.
| Compound Name | 2-[[1-[3-[(4-chlorophenyl)-hydroxymethyl]cyclopentyl]pyrazolo[3,4-d]pyrimidin-4-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 142419678 |
| Molecular Formula | C19H19ClN6O |
| Molecular Weight | 382.86 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-[[1-[3-[(4-chlorophenyl)-hydroxymethyl]cyclopentyl]pyrazolo[3,4-d]pyrimidin-4-yl]amino]acetonitrile |
| SMILES | N#CCNc1ncnc2c1cnn2C1CCC(C(O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H19ClN6O/c20-14-4-1-12(2-5-14)17(27)13-3-6-15(9-13)26-19-16(10-25-26)18(22-8-7-21)23-11-24-19/h1-2,4-5,10-11,13,15,17,27H,3,6,8-9H2,(H,22,23,24) |
| InChIKey | BVFJHIOUANJOJG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.86 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|