C19H16Cl2N6 — CID 52951669
1-[2-chloro-2-(4-chlorophenyl)ethyl]-N-(pyridin-2-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 52951669) has the molecular formula C19H16Cl2N6 and a molecular weight of 399.29 g/mol. Its IUPAC name is 1-[2-chloro-2-(4-chlorophenyl)ethyl]-N-(pyridin-2-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[2-chloro-2-(4-chlorophenyl)ethyl]-N-(pyridin-2-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 52951669 |
| Molecular Formula | C19H16Cl2N6 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 1-[2-chloro-2-(4-chlorophenyl)ethyl]-N-(pyridin-2-ylmethyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Clc1ccc(C(Cl)Cn2ncc3c(NCc4ccccn4)ncnc32)cc1 |
| InChI | InChI=1S/C19H16Cl2N6/c20-14-6-4-13(5-7-14)17(21)11-27-19-16(10-26-27)18(24-12-25-19)23-9-15-3-1-2-8-22-15/h1-8,10,12,17H,9,11H2,(H,23,24,25) |
| InChIKey | IMBPFCCEWUQKON-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|