C21H19BrClN5O — CID 71745299
1-[2-(4-bromophenyl)-2-chloroethyl]-N-[(3-methoxyphenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 71745299) has the molecular formula C21H19BrClN5O and a molecular weight of 472.77 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)-2-chloroethyl]-N-[(3-methoxyphenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[2-(4-bromophenyl)-2-chloroethyl]-N-[(3-methoxyphenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 71745299 |
| Molecular Formula | C21H19BrClN5O |
| Molecular Weight | 472.77 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 1-[2-(4-bromophenyl)-2-chloroethyl]-N-[(3-methoxyphenyl)methyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | COc1cccc(CNc2ncnc3c2cnn3CC(Cl)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C21H19BrClN5O/c1-29-17-4-2-3-14(9-17)10-24-20-18-11-27-28(21(18)26-13-25-20)12-19(23)15-5-7-16(22)8-6-15/h2-9,11,13,19H,10,12H2,1H3,(H,24,25,26) |
| InChIKey | NUUVDLXJSUQIGF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.77 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|