C21H21N5O — CID 11371816
1-phenyl-2-[4-(2-phenylethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethanol (PubChem CID 11371816) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-phenyl-2-[4-(2-phenylethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethanol.
| Compound Name | 1-phenyl-2-[4-(2-phenylethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethanol |
|---|---|
| PubChem CID | 11371816 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-phenyl-2-[4-(2-phenylethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]ethanol |
| SMILES | OC(Cn1ncc2c(NCCc3ccccc3)ncnc21)c1ccccc1 |
| InChI | InChI=1S/C21H21N5O/c27-19(17-9-5-2-6-10-17)14-26-21-18(13-25-26)20(23-15-24-21)22-12-11-16-7-3-1-4-8-16/h1-10,13,15,19,27H,11-12,14H2,(H,22,23,24) |
| InChIKey | MWGRSUFXCMYXGU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |