C25H28ClN5S — CID 121316145
6-butylsulfanyl-1-(2-chloro-2-phenylethyl)-N-(2-phenylethyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 121316145) has the molecular formula C25H28ClN5S and a molecular weight of 466.05 g/mol. Its IUPAC name is 6-butylsulfanyl-1-(2-chloro-2-phenylethyl)-N-(2-phenylethyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-butylsulfanyl-1-(2-chloro-2-phenylethyl)-N-(2-phenylethyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 121316145 |
| Molecular Formula | C25H28ClN5S |
| Molecular Weight | 466.05 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 6-butylsulfanyl-1-(2-chloro-2-phenylethyl)-N-(2-phenylethyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCCSc1nc(NCCc2ccccc2)c2cnn(CC(Cl)c3ccccc3)c2n1 |
| InChI | InChI=1S/C25H28ClN5S/c1-2-3-16-32-25-29-23(27-15-14-19-10-6-4-7-11-19)21-17-28-31(24(21)30-25)18-22(26)20-12-8-5-9-13-20/h4-13,17,22H,2-3,14-16,18H2,1H3,(H,27,29,30) |
| InChIKey | GJWWKPZIJUCYJC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.05 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|