C19H22ClN5S — CID 11153440
1-(2-chloro-2-phenylethyl)-6-methylsulfanyl-4-piperidin-1-ylpyrazolo[5,4-d]pyrimidine (PubChem CID 11153440) has the molecular formula C19H22ClN5S and a molecular weight of 387.94 g/mol. Its IUPAC name is 1-(2-chloro-2-phenylethyl)-6-methylsulfanyl-4-piperidin-1-ylpyrazolo[5,4-d]pyrimidine.
| Compound Name | 1-(2-chloro-2-phenylethyl)-6-methylsulfanyl-4-piperidin-1-ylpyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 11153440 |
| Molecular Formula | C19H22ClN5S |
| Molecular Weight | 387.94 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-(2-chloro-2-phenylethyl)-6-methylsulfanyl-4-piperidin-1-ylpyrazolo[5,4-d]pyrimidine |
| SMILES | CSc1nc(N2CCCCC2)c2cnn(CC(Cl)c3ccccc3)c2n1 |
| InChI | InChI=1S/C19H22ClN5S/c1-26-19-22-17(24-10-6-3-7-11-24)15-12-21-25(18(15)23-19)13-16(20)14-8-4-2-5-9-14/h2,4-5,8-9,12,16H,3,6-7,10-11,13H2,1H3 |
| InChIKey | RLTNCWZNNOAYJB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.94 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|