C22H21ClFN5S — CID 25189269
1-(2-chloro-2-phenylethyl)-N-[2-(2-fluorophenyl)ethyl]-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 25189269) has the molecular formula C22H21ClFN5S and a molecular weight of 441.96 g/mol. Its IUPAC name is 1-(2-chloro-2-phenylethyl)-N-[2-(2-fluorophenyl)ethyl]-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-(2-chloro-2-phenylethyl)-N-[2-(2-fluorophenyl)ethyl]-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 25189269 |
| Molecular Formula | C22H21ClFN5S |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 1-(2-chloro-2-phenylethyl)-N-[2-(2-fluorophenyl)ethyl]-6-methylsulfanylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CSc1nc(NCCc2ccccc2F)c2cnn(CC(Cl)c3ccccc3)c2n1 |
| InChI | InChI=1S/C22H21ClFN5S/c1-30-22-27-20(25-12-11-16-9-5-6-10-19(16)24)17-13-26-29(21(17)28-22)14-18(23)15-7-3-2-4-8-15/h2-10,13,18H,11-12,14H2,1H3,(H,25,27,28) |
| InChIKey | UJWABHNRWWDLKV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|