C19H20N6O — CID 86774098
2-[4-[2-(naphthalen-1-ylamino)ethylamino]pyrazolo[3,4-d]pyrimidin-1-yl]ethanol (PubChem CID 86774098) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-[4-[2-(naphthalen-1-ylamino)ethylamino]pyrazolo[3,4-d]pyrimidin-1-yl]ethanol.
| Compound Name | 2-[4-[2-(naphthalen-1-ylamino)ethylamino]pyrazolo[3,4-d]pyrimidin-1-yl]ethanol |
|---|---|
| PubChem CID | 86774098 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-[4-[2-(naphthalen-1-ylamino)ethylamino]pyrazolo[3,4-d]pyrimidin-1-yl]ethanol |
| SMILES | OCCn1ncc2c(NCCNc3cccc4ccccc34)ncnc21 |
| InChI | InChI=1S/C19H20N6O/c26-11-10-25-19-16(12-24-25)18(22-13-23-19)21-9-8-20-17-7-3-5-14-4-1-2-6-15(14)17/h1-7,12-13,20,26H,8-11H2,(H,21,22,23) |
| InChIKey | ZUQRGNJNJNUIFZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|