C20H18ClF2N3O3 — CID 122482624
7-[(3aR,4R,6R,6aR)-6-[(4-fluorophenyl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-chloro-5-fluoropyrrolo[2,3-d]pyrimidine (PubChem CID 122482624) has the molecular formula C20H18ClF2N3O3 and a molecular weight of 421.83 g/mol. Its IUPAC name is 7-[(3aR,4R,6R,6aR)-6-[(4-fluorophenyl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-chloro-5-fluoropyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-[(3aR,4R,6R,6aR)-6-[(4-fluorophenyl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-chloro-5-fluoropyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 122482624 |
| Molecular Formula | C20H18ClF2N3O3 |
| Molecular Weight | 421.83 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 7-[(3aR,4R,6R,6aR)-6-[(4-fluorophenyl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-chloro-5-fluoropyrrolo[2,3-d]pyrimidine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Cc1ccc(F)cc1)O[C@H]2n1cc(F)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C20H18ClF2N3O3/c1-20(2)28-15-13(7-10-3-5-11(22)6-4-10)27-19(16(15)29-20)26-8-12(23)14-17(21)24-9-25-18(14)26/h3-6,8-9,13,15-16,19H,7H2,1-2H3/t13-,15-,16-,19-/m1/s1 |
| InChIKey | RIKNJGPMOAKUJA-NVQRDWNXSA-N |
| XLogP | 4.02 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.83 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |