C18H17F2N3O3 — CID 122496795
(2R,3R,4S,5R)-2-(5-fluoro-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(4-fluorophenyl)methyl]oxolane-3,4-diol (PubChem CID 122496795) has the molecular formula C18H17F2N3O3 and a molecular weight of 361.35 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(5-fluoro-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(4-fluorophenyl)methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(5-fluoro-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(4-fluorophenyl)methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 122496795 |
| Molecular Formula | C18H17F2N3O3 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (2R,3R,4S,5R)-2-(5-fluoro-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(4-fluorophenyl)methyl]oxolane-3,4-diol |
| SMILES | Cc1ncnc2c1c(F)cn2[C@@H]1O[C@H](Cc2ccc(F)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H17F2N3O3/c1-9-14-12(20)7-23(17(14)22-8-21-9)18-16(25)15(24)13(26-18)6-10-2-4-11(19)5-3-10/h2-5,7-8,13,15-16,18,24-25H,6H2,1H3/t13-,15-,16-,18-/m1/s1 |
| InChIKey | XPDCNILXSOGCRW-GFOCRRMGSA-N |
| XLogP | 1.88 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |