C14H18FN3O4 — CID 90348039
(2R,3R,4R,5R)-2-(5-fluoro-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1S)-1-hydroxyethyl]-3-methyloxolane-3,4-diol (PubChem CID 90348039) has the molecular formula C14H18FN3O4 and a molecular weight of 311.31 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(5-fluoro-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1S)-1-hydroxyethyl]-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(5-fluoro-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1S)-1-hydroxyethyl]-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 90348039 |
| Molecular Formula | C14H18FN3O4 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (2R,3R,4R,5R)-2-(5-fluoro-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-5-[(1S)-1-hydroxyethyl]-3-methyloxolane-3,4-diol |
| SMILES | Cc1ncnc2c1c(F)cn2[C@@H]1O[C@H]([C@H](C)O)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C14H18FN3O4/c1-6-9-8(15)4-18(12(9)17-5-16-6)13-14(3,21)11(20)10(22-13)7(2)19/h4-5,7,10-11,13,19-21H,1-3H3/t7-,10+,11+,13+,14+/m0/s1 |
| InChIKey | QXOCNUUSNRPVAC-DMBDQUIWSA-N |
| XLogP | 0.27 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |