C18H17FN4O3S — CID 171351880
(2R,3R,4R,5R)-4-fluoro-2-(hydroxymethyl)-4-methyl-5-[4-methyl-5-[2-(1,3-thiazol-2-yl)ethynyl]pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-3-ol (PubChem CID 171351880) has the molecular formula C18H17FN4O3S and a molecular weight of 388.42 g/mol. Its IUPAC name is (2R,3R,4R,5R)-4-fluoro-2-(hydroxymethyl)-4-methyl-5-[4-methyl-5-[2-(1,3-thiazol-2-yl)ethynyl]pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-4-fluoro-2-(hydroxymethyl)-4-methyl-5-[4-methyl-5-[2-(1,3-thiazol-2-yl)ethynyl]pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 171351880 |
| Molecular Formula | C18H17FN4O3S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | (2R,3R,4R,5R)-4-fluoro-2-(hydroxymethyl)-4-methyl-5-[4-methyl-5-[2-(1,3-thiazol-2-yl)ethynyl]pyrrolo[2,3-d]pyrimidin-7-yl]oxolan-3-ol |
| SMILES | Cc1ncnc2c1c(C#Cc1nccs1)cn2[C@@H]1O[C@H](CO)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C18H17FN4O3S/c1-10-14-11(3-4-13-20-5-6-27-13)7-23(16(14)22-9-21-10)17-18(2,19)15(25)12(8-24)26-17/h5-7,9,12,15,17,24-25H,8H2,1-2H3/t12-,15-,17-,18-/m1/s1 |
| InChIKey | LPQLMEHTEGQNAR-DGCUDZEOSA-N |
| XLogP | 1.57 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|