C16H19FN4O4 — CID 58732421
(4R,5R)-5-[4-(ethoxyamino)-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 58732421) has the molecular formula C16H19FN4O4 and a molecular weight of 350.35 g/mol. Its IUPAC name is (4R,5R)-5-[4-(ethoxyamino)-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (4R,5R)-5-[4-(ethoxyamino)-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 58732421 |
| Molecular Formula | C16H19FN4O4 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (4R,5R)-5-[4-(ethoxyamino)-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | C#Cc1cn([C@@H]2OC(CO)C(O)[C@@]2(C)F)c2ncnc(NOCC)c12 |
| InChI | InChI=1S/C16H19FN4O4/c1-4-9-6-21(15-16(3,17)12(23)10(7-22)25-15)14-11(9)13(18-8-19-14)20-24-5-2/h1,6,8,10,12,15,22-23H,5,7H2,2-3H3,(H,18,19,20)/t10?,12?,15-,16-/m1/s1 |
| InChIKey | GXGJPVYIXABCHJ-UGGLIUNPSA-N |
| XLogP | 0.75 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|