C12H14FN7O3 — CID 173482500
(2R,3S,4R,5S)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-azido-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 173482500) has the molecular formula C12H14FN7O3 and a molecular weight of 323.29 g/mol. Its IUPAC name is (2R,3S,4R,5S)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-azido-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (2R,3S,4R,5S)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-azido-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 173482500 |
| Molecular Formula | C12H14FN7O3 |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (2R,3S,4R,5S)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-azido-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | C[C@@]1(N=[N+]=[N-])[C@H](O)[C@@H](CO)O[C@@H]1n1cc(F)c2c(N)ncnc21 |
| InChI | InChI=1S/C12H14FN7O3/c1-12(18-19-15)8(22)6(3-21)23-11(12)20-2-5(13)7-9(14)16-4-17-10(7)20/h2,4,6,8,11,21-22H,3H2,1H3,(H2,14,16,17)/t6-,8-,11+,12-/m1/s1 |
| InChIKey | SSNXUNQHLJIEOV-RMEKTUJTSA-N |
| XLogP | 0.47 |
| TPSA | 155.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|