C15H16FN5O4 — CID 135270926
(2R,3R,4S,5R)-2-[4-(1,4-dihydropyrimidin-5-yl)-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 135270926) has the molecular formula C15H16FN5O4 and a molecular weight of 349.32 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[4-(1,4-dihydropyrimidin-5-yl)-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[4-(1,4-dihydropyrimidin-5-yl)-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 135270926 |
| Molecular Formula | C15H16FN5O4 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (2R,3R,4S,5R)-2-[4-(1,4-dihydropyrimidin-5-yl)-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cc(F)c3c(C4=CNC=NC4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H16FN5O4/c16-8-3-21(15-13(24)12(23)9(4-22)25-15)14-10(8)11(19-6-20-14)7-1-17-5-18-2-7/h1,3,5-6,9,12-13,15,22-24H,2,4H2,(H,17,18)/t9-,12-,13-,15-/m1/s1 |
| InChIKey | RDFKOQIUJJOMNX-QGMIFYJMSA-N |
| XLogP | -0.85 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |