C23H21ClN4O4 — CID 126637699
5-[[(3aR,4R,6R,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]quinoline (PubChem CID 126637699) has the molecular formula C23H21ClN4O4 and a molecular weight of 452.90 g/mol. Its IUPAC name is 5-[[(3aR,4R,6R,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]quinoline.
| Compound Name | 5-[[(3aR,4R,6R,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]quinoline |
|---|---|
| PubChem CID | 126637699 |
| Molecular Formula | C23H21ClN4O4 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 5-[[(3aR,4R,6R,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]quinoline |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COc1cccc3ncccc13)O[C@H]2n1ccc2c(Cl)ncnc21 |
| InChI | InChI=1S/C23H21ClN4O4/c1-23(2)31-18-17(11-29-16-7-3-6-15-13(16)5-4-9-25-15)30-22(19(18)32-23)28-10-8-14-20(24)26-12-27-21(14)28/h3-10,12,17-19,22H,11H2,1-2H3/t17-,18-,19-,22-/m1/s1 |
| InChIKey | KGQDWOHWYBLBGK-JPAWQOSXSA-N |
| XLogP | 4.13 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |