C23H21ClN4O3S — CID 126637721
7-[[(3aR,4R,6S,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]quinoline (PubChem CID 126637721) has the molecular formula C23H21ClN4O3S and a molecular weight of 468.97 g/mol. Its IUPAC name is 7-[[(3aR,4R,6S,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]quinoline.
| Compound Name | 7-[[(3aR,4R,6S,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]quinoline |
|---|---|
| PubChem CID | 126637721 |
| Molecular Formula | C23H21ClN4O3S |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 7-[[(3aR,4R,6S,6aS)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylsulfanyl]quinoline |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CSc1ccc3cccnc3c1)O[C@H]2n1ccc2c(Cl)ncnc21 |
| InChI | InChI=1S/C23H21ClN4O3S/c1-23(2)30-18-17(11-32-14-6-5-13-4-3-8-25-16(13)10-14)29-22(19(18)31-23)28-9-7-15-20(24)26-12-27-21(15)28/h3-10,12,17-19,22H,11H2,1-2H3/t17-,18-,19-,22-/m1/s1 |
| InChIKey | MHGLPQWWSILAIZ-JPAWQOSXSA-N |
| XLogP | 4.84 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |