C23H21BrClN5O3 — CID 126637966
N-[[(3aR,4R,6R,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-3-bromoquinolin-7-amine (PubChem CID 126637966) has the molecular formula C23H21BrClN5O3 and a molecular weight of 530.81 g/mol. Its IUPAC name is N-[[(3aR,4R,6R,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-3-bromoquinolin-7-amine.
| Compound Name | N-[[(3aR,4R,6R,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-3-bromoquinolin-7-amine |
|---|---|
| PubChem CID | 126637966 |
| Molecular Formula | C23H21BrClN5O3 |
| Molecular Weight | 530.81 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | N-[[(3aR,4R,6R,6aR)-4-(4-chloropyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-3-bromoquinolin-7-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CNc1ccc3cc(Br)cnc3c1)O[C@H]2n1ccc2c(Cl)ncnc21 |
| InChI | InChI=1S/C23H21BrClN5O3/c1-23(2)32-18-17(10-26-14-4-3-12-7-13(24)9-27-16(12)8-14)31-22(19(18)33-23)30-6-5-15-20(25)28-11-29-21(15)30/h3-9,11,17-19,22,26H,10H2,1-2H3/t17-,18-,19-,22-/m1/s1 |
| InChIKey | ROPCLRHTAJAWQC-JPAWQOSXSA-N |
| XLogP | 4.93 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.81 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |