C14H14ClIN6O3 — CID 10504781
7-[(3aR,4R,6R,6aR)-6-(azidomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-chloro-5-iodopyrrolo[2,3-d]pyrimidine (PubChem CID 10504781) has the molecular formula C14H14ClIN6O3 and a molecular weight of 476.66 g/mol. Its IUPAC name is 7-[(3aR,4R,6R,6aR)-6-(azidomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-chloro-5-iodopyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-[(3aR,4R,6R,6aR)-6-(azidomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-chloro-5-iodopyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 10504781 |
| Molecular Formula | C14H14ClIN6O3 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | 7-[(3aR,4R,6R,6aR)-6-(azidomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-4-chloro-5-iodopyrrolo[2,3-d]pyrimidine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CN=[N+]=[N-])O[C@H]2n1cc(I)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C14H14ClIN6O3/c1-14(2)24-9-7(3-20-21-17)23-13(10(9)25-14)22-4-6(16)8-11(15)18-5-19-12(8)22/h4-5,7,9-10,13H,3H2,1-2H3/t7-,9-,10-,13-/m1/s1 |
| InChIKey | YRDKKCKACHQJKD-QYVSTXNMSA-N |
| XLogP | 3.42 |
| TPSA | 107.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|