C14H17B2ClIN3O4 — CID 21040818
CID 21040818 (PubChem CID 21040818) has the molecular formula C14H17B2ClIN3O4 and a molecular weight of 475.29 g/mol.
| Compound Name | CID 21040818 |
|---|---|
| PubChem CID | 21040818 |
| Molecular Formula | C14H17B2ClIN3O4 |
| Molecular Weight | 475.29 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | — |
| SMILES | C[B]OCC1OC(n2cc(I)c3c(Cl)ncnc32)C(C)(O)C1O[B]C |
| InChI | InChI=1S/C14H17B2ClIN3O4/c1-14(22)10(25-16-3)8(5-23-15-2)24-13(14)21-4-7(18)9-11(17)19-6-20-12(9)21/h4,6,8,10,13,22H,5H2,1-3H3 |
| InChIKey | RDYAYTZOVRQOPK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|