C15H18B2ClN3O5 — CID 21040839
CID 21040839 (PubChem CID 21040839) has the molecular formula C15H18B2ClN3O5 and a molecular weight of 377.40 g/mol.
| Compound Name | CID 21040839 |
|---|---|
| PubChem CID | 21040839 |
| Molecular Formula | C15H18B2ClN3O5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | — |
| SMILES | C[B]OCC1OC(n2cc(C=O)c3c(Cl)ncnc32)C(C)(O)C1O[B]C |
| InChI | InChI=1S/C15H18B2ClN3O5/c1-15(23)11(26-17-3)9(6-24-16-2)25-14(15)21-4-8(5-22)10-12(18)19-7-20-13(10)21/h4-5,7,9,11,14,23H,6H2,1-3H3 |
| InChIKey | CGLPPNNOXKAUMY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|