C18H19ClN4O9 — CID 21040846
[3,4-diacetyloxy-5-(4-chloro-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-4-methyloxolan-2-yl]methyl acetate (PubChem CID 21040846) has the molecular formula C18H19ClN4O9 and a molecular weight of 470.82 g/mol. Its IUPAC name is [3,4-diacetyloxy-5-(4-chloro-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-4-methyloxolan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-5-(4-chloro-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-4-methyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 21040846 |
| Molecular Formula | C18H19ClN4O9 |
| Molecular Weight | 470.82 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | [3,4-diacetyloxy-5-(4-chloro-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-4-methyloxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2cc([N+](=O)[O-])c3c(Cl)ncnc32)C(C)(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H19ClN4O9/c1-8(24)29-6-12-14(30-9(2)25)18(4,32-10(3)26)17(31-12)22-5-11(23(27)28)13-15(19)20-7-21-16(13)22/h5,7,12,14,17H,6H2,1-4H3 |
| InChIKey | HCLVAPQTXKIEJJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 161.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.82 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|