C22H30N6O7S — CID 71010362
[(2R,3R,4R)-3,4-diacetyloxy-5-[5-amino-4-(dimethylaminomethylideneamino)-2-methylsulfanylpyrrolo[2,3-d]pyrimidin-7-yl]-4-methyloxolan-2-yl]methyl acetate (PubChem CID 71010362) has the molecular formula C22H30N6O7S and a molecular weight of 522.58 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-diacetyloxy-5-[5-amino-4-(dimethylaminomethylideneamino)-2-methylsulfanylpyrrolo[2,3-d]pyrimidin-7-yl]-4-methyloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R)-3,4-diacetyloxy-5-[5-amino-4-(dimethylaminomethylideneamino)-2-methylsulfanylpyrrolo[2,3-d]pyrimidin-7-yl]-4-methyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71010362 |
| Molecular Formula | C22H30N6O7S |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | [(2R,3R,4R)-3,4-diacetyloxy-5-[5-amino-4-(dimethylaminomethylideneamino)-2-methylsulfanylpyrrolo[2,3-d]pyrimidin-7-yl]-4-methyloxolan-2-yl]methyl acetate |
| SMILES | CSc1nc(N=CN(C)C)c2c(N)cn(C3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@]3(C)OC(C)=O)c2n1 |
| InChI | InChI=1S/C22H30N6O7S/c1-11(29)32-9-15-17(33-12(2)30)22(4,35-13(3)31)20(34-15)28-8-14(23)16-18(24-10-27(5)6)25-21(36-7)26-19(16)28/h8,10,15,17,20H,9,23H2,1-7H3/t15-,17-,20?,22-/m1/s1 |
| InChIKey | FINUPFRRJVLOHX-LYFFMUHPSA-N |
| XLogP | 1.67 |
| TPSA | 160.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|