C22H24N4O8 — CID 58959158
[(2R,3R,4R)-3,4-diacetyloxy-5-(10-methoxy-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),9,11-hexaen-3-yl)-4-methyloxolan-2-yl]methyl acetate (PubChem CID 58959158) has the molecular formula C22H24N4O8 and a molecular weight of 472.45 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-diacetyloxy-5-(10-methoxy-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),9,11-hexaen-3-yl)-4-methyloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R)-3,4-diacetyloxy-5-(10-methoxy-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),9,11-hexaen-3-yl)-4-methyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58959158 |
| Molecular Formula | C22H24N4O8 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | [(2R,3R,4R)-3,4-diacetyloxy-5-(10-methoxy-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),9,11-hexaen-3-yl)-4-methyloxolan-2-yl]methyl acetate |
| SMILES | COC1=Nc2ncnc3c2c(cn3C2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@]2(C)OC(C)=O)C=C1 |
| InChI | InChI=1S/C22H24N4O8/c1-11(27)31-9-15-18(32-12(2)28)22(4,34-13(3)29)21(33-15)26-8-14-6-7-16(30-5)25-19-17(14)20(26)24-10-23-19/h6-8,10,15,18,21H,9H2,1-5H3/t15-,18-,21?,22-/m1/s1 |
| InChIKey | KSXMHSNPPHKXAS-GMZXHYAFSA-N |
| XLogP | 1.85 |
| TPSA | 140.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|