C21H24ClN5O10S — CID 162117225
[(2R,3R,4S)-3,4-diacetyloxy-5-[4-[(2-chloroacetyl)amino]-2-methylsulfanyl-5-nitropyrrolo[2,3-d]pyrimidin-7-yl]-4-methyloxolan-2-yl]methyl acetate (PubChem CID 162117225) has the molecular formula C21H24ClN5O10S and a molecular weight of 573.97 g/mol. Its IUPAC name is [(2R,3R,4S)-3,4-diacetyloxy-5-[4-[(2-chloroacetyl)amino]-2-methylsulfanyl-5-nitropyrrolo[2,3-d]pyrimidin-7-yl]-4-methyloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S)-3,4-diacetyloxy-5-[4-[(2-chloroacetyl)amino]-2-methylsulfanyl-5-nitropyrrolo[2,3-d]pyrimidin-7-yl]-4-methyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162117225 |
| Molecular Formula | C21H24ClN5O10S |
| Molecular Weight | 573.97 g/mol |
| Exact Mass | 573.09 |
| IUPAC Name | [(2R,3R,4S)-3,4-diacetyloxy-5-[4-[(2-chloroacetyl)amino]-2-methylsulfanyl-5-nitropyrrolo[2,3-d]pyrimidin-7-yl]-4-methyloxolan-2-yl]methyl acetate |
| SMILES | CSc1nc(NC(=O)CCl)c2c([N+](=O)[O-])cn(C3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@]3(C)OC(C)=O)c2n1 |
| InChI | InChI=1S/C21H24ClN5O10S/c1-9(28)34-8-13-16(35-10(2)29)21(4,37-11(3)30)19(36-13)26-7-12(27(32)33)15-17(23-14(31)6-22)24-20(38-5)25-18(15)26/h7,13,16,19H,6,8H2,1-5H3,(H,23,24,25,31)/t13-,16-,19?,21+/m1/s1 |
| InChIKey | NAIATJVMRZVYMN-FLYRILDRSA-N |
| XLogP | 1.95 |
| TPSA | 191.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.97 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|