C17H22N4O5S — CID 76798936
[3-acetyloxy-4-methyl-5-(6-methyl-2-methylsulfanylpurin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 76798936) has the molecular formula C17H22N4O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is [3-acetyloxy-4-methyl-5-(6-methyl-2-methylsulfanylpurin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-4-methyl-5-(6-methyl-2-methylsulfanylpurin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 76798936 |
| Molecular Formula | C17H22N4O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [3-acetyloxy-4-methyl-5-(6-methyl-2-methylsulfanylpurin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CSc1nc(C)c2ncn(C3OC(COC(C)=O)C(OC(C)=O)C3C)c2n1 |
| InChI | InChI=1S/C17H22N4O5S/c1-8-14(25-11(4)23)12(6-24-10(3)22)26-16(8)21-7-18-13-9(2)19-17(27-5)20-15(13)21/h7-8,12,14,16H,6H2,1-5H3 |
| InChIKey | QEEFDYAKHIOBBU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |