C18H21N5O9 — CID 71066335
[(2R,3R,5R)-3,4-diacetyloxy-5-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-4-methyloxolan-2-yl]methyl acetate (PubChem CID 71066335) has the molecular formula C18H21N5O9 and a molecular weight of 451.39 g/mol. Its IUPAC name is [(2R,3R,5R)-3,4-diacetyloxy-5-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-4-methyloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,5R)-3,4-diacetyloxy-5-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-4-methyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71066335 |
| Molecular Formula | C18H21N5O9 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | [(2R,3R,5R)-3,4-diacetyloxy-5-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-4-methyloxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc([N+](=O)[O-])c3c(N)ncnc32)C(C)(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H21N5O9/c1-8(24)29-6-12-14(30-9(2)25)18(4,32-10(3)26)17(31-12)22-5-11(23(27)28)13-15(19)20-7-21-16(13)22/h5,7,12,14,17H,6H2,1-4H3,(H2,19,20,21)/t12-,14-,17-,18?/m1/s1 |
| InChIKey | ZKOPOXTVMQVCBX-GLDAMNTNSA-N |
| XLogP | 0.64 |
| TPSA | 188.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|