C13H17N5O5W — CID 58645396
(2R,3R)-2-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)-3,4-dimethyloxolan-3-ol;tungsten (PubChem CID 58645396) has the molecular formula C13H17N5O5W and a molecular weight of 507.15 g/mol. Its IUPAC name is (2R,3R)-2-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)-3,4-dimethyloxolan-3-ol;tungsten.
| Compound Name | (2R,3R)-2-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)-3,4-dimethyloxolan-3-ol;tungsten |
|---|---|
| PubChem CID | 58645396 |
| Molecular Formula | C13H17N5O5W |
| Molecular Weight | 507.15 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | (2R,3R)-2-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)-3,4-dimethyloxolan-3-ol;tungsten |
| SMILES | CC1C(CO)O[C@@H](n2cc([N+](=O)[O-])c3c(N)ncnc32)[C@]1(C)O.[W] |
| InChI | InChI=1S/C13H17N5O5.W/c1-6-8(4-19)23-12(13(6,2)20)17-3-7(18(21)22)9-10(14)15-5-16-11(9)17;/h3,5-6,8,12,19-20H,4H2,1-2H3,(H2,14,15,16);/t6?,8?,12-,13-;/m1./s1 |
| InChIKey | KORYNPLDSNLRLN-JNXYMRLMSA-N |
| XLogP | 0.20 |
| TPSA | 149.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.15 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|