C20H28N4O5 — CID 89347101
(4R)-2-[4-amino-5-(3,3-diethoxyprop-1-ynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3,4-dimethyloxolan-3-ol (PubChem CID 89347101) has the molecular formula C20H28N4O5 and a molecular weight of 404.47 g/mol. Its IUPAC name is (4R)-2-[4-amino-5-(3,3-diethoxyprop-1-ynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3,4-dimethyloxolan-3-ol.
| Compound Name | (4R)-2-[4-amino-5-(3,3-diethoxyprop-1-ynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3,4-dimethyloxolan-3-ol |
|---|---|
| PubChem CID | 89347101 |
| Molecular Formula | C20H28N4O5 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (4R)-2-[4-amino-5-(3,3-diethoxyprop-1-ynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3,4-dimethyloxolan-3-ol |
| SMILES | CCOC(C#Cc1cn(C2OC(CO)[C@@H](C)C2(C)O)c2ncnc(N)c12)OCC |
| InChI | InChI=1S/C20H28N4O5/c1-5-27-15(28-6-2)8-7-13-9-24(18-16(13)17(21)22-11-23-18)19-20(4,26)12(3)14(10-25)29-19/h9,11-12,14-15,19,25-26H,5-6,10H2,1-4H3,(H2,21,22,23)/t12-,14?,19?,20?/m1/s1 |
| InChIKey | OJXCKRFFCIBQIC-GLUYVYHMSA-N |
| XLogP | 1.04 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|