C18H20IN3O8 — CID 135979783
[(2R,3R,4S,5S)-3,4-diacetyloxy-5-(5-iodo-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-methyloxolan-2-yl]methyl acetate (PubChem CID 135979783) has the molecular formula C18H20IN3O8 and a molecular weight of 533.28 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,4-diacetyloxy-5-(5-iodo-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-methyloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S)-3,4-diacetyloxy-5-(5-iodo-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-methyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135979783 |
| Molecular Formula | C18H20IN3O8 |
| Molecular Weight | 533.28 g/mol |
| Exact Mass | 533.03 |
| IUPAC Name | [(2R,3R,4S,5S)-3,4-diacetyloxy-5-(5-iodo-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-methyloxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2cc(I)c3c(=O)[nH]cnn23)[C@](C)(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H20IN3O8/c1-8(23)27-6-13-16(28-9(2)24)18(4,30-10(3)25)15(29-13)12-5-11(19)14-17(26)20-7-21-22(12)14/h5,7,13,15-16H,6H2,1-4H3,(H,20,21,26)/t13-,15+,16-,18+/m1/s1 |
| InChIKey | YUDGBAKSUNPZON-VUNQQRPYSA-N |
| XLogP | 0.88 |
| TPSA | 138.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|