C19H20ClNO5 — CID 137479766
(3aR,5R,6R,6aR)-5-[(2-chloroquinolin-7-yl)oxymethyl]-6-ethenyl-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol (PubChem CID 137479766) has the molecular formula C19H20ClNO5 and a molecular weight of 377.82 g/mol. Its IUPAC name is (3aR,5R,6R,6aR)-5-[(2-chloroquinolin-7-yl)oxymethyl]-6-ethenyl-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5R,6R,6aR)-5-[(2-chloroquinolin-7-yl)oxymethyl]-6-ethenyl-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 137479766 |
| Molecular Formula | C19H20ClNO5 |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | (3aR,5R,6R,6aR)-5-[(2-chloroquinolin-7-yl)oxymethyl]-6-ethenyl-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-ol |
| SMILES | C=C[C@@]1(O)[C@@H](COc2ccc3ccc(Cl)nc3c2)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C19H20ClNO5/c1-4-19(22)14(24-17-16(19)25-18(2,3)26-17)10-23-12-7-5-11-6-8-15(20)21-13(11)9-12/h4-9,14,16-17,22H,1,10H2,2-3H3/t14-,16+,17-,19-/m1/s1 |
| InChIKey | ZDHLKDZZEDBRGW-NOCIGQNYSA-N |
| XLogP | 3.06 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|