C17H17ClO6 — CID 124891043
[(3aS,5S,6S,6aS)-6-ethynyl-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-chlorobenzoate (PubChem CID 124891043) has the molecular formula C17H17ClO6 and a molecular weight of 352.77 g/mol. Its IUPAC name is [(3aS,5S,6S,6aS)-6-ethynyl-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-chlorobenzoate.
| Compound Name | [(3aS,5S,6S,6aS)-6-ethynyl-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 124891043 |
| Molecular Formula | C17H17ClO6 |
| Molecular Weight | 352.77 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | [(3aS,5S,6S,6aS)-6-ethynyl-6-hydroxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methyl 4-chlorobenzoate |
| SMILES | C#C[C@]1(O)[C@H](COC(=O)c2ccc(Cl)cc2)O[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C17H17ClO6/c1-4-17(20)12(22-15-13(17)23-16(2,3)24-15)9-21-14(19)10-5-7-11(18)8-6-10/h1,5-8,12-13,15,20H,9H2,2-3H3/t12-,13+,15-,17-/m0/s1 |
| InChIKey | HDJGOJJSEKOAAY-YXPYIKCWSA-N |
| XLogP | 1.74 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.77 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|